C17H22N2O4S — CID 843162
(1S,2S,3S,4R)-3-[[(5-propan-2-ylthiophene-3-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 843162) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[[(5-propan-2-ylthiophene-3-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[[(5-propan-2-ylthiophene-3-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 843162 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (1S,2S,3S,4R)-3-[[(5-propan-2-ylthiophene-3-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)c1cc(C(=O)NNC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C(=O)O)cs1 |
| InChI | InChI=1S/C17H22N2O4S/c1-8(2)12-6-11(7-24-12)15(20)18-19-16(21)13-9-3-4-10(5-9)14(13)17(22)23/h6-10,13-14H,3-5H2,1-2H3,(H,18,20)(H,19,21)(H,22,23)/t9-,10+,13+,14+/m1/s1 |
| InChIKey | SISFLLOZVHOGGF-OAACRXHESA-N |
| XLogP | 2.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|