About 1-phenylethyl propanoate
1-phenylethyl propanoate (PubChem CID 8432) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-phenylethyl propanoate.
Molecular Properties
| Compound Name | 1-phenylethyl propanoate |
| PubChem CID | 8432 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-phenylethyl propanoate |
| SMILES | CCC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-3-11(12)13-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| InChIKey | WCIQNYOXLZQQMU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl propanoate?
The IUPAC name of 1-phenylethyl propanoate (CID 8432) is 1-phenylethyl propanoate.
What is the SMILES notation for 1-phenylethyl propanoate?
The canonical SMILES for 1-phenylethyl propanoate is CCC(=O)OC(C)c1ccccc1.
What is the InChIKey of 1-phenylethyl propanoate?
The InChIKey is WCIQNYOXLZQQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-3-11(12)13-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3.
What are the key properties of 1-phenylethyl propanoate?
1-phenylethyl propanoate has a molecular weight of 178.23 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl propanoate is sourced from PubChem (CID 8432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).