About 4-bromo-1,5-dimethylpyrazole-3-carboxamide
4-bromo-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 843437) has the molecular formula C6H8BrN3O
and a molecular weight of 218.05 g/mol. Its IUPAC name is 4-bromo-1,5-dimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-1,5-dimethylpyrazole-3-carboxamide |
| PubChem CID | 843437 |
| Molecular Formula | C6H8BrN3O |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 4-bromo-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1c(Br)c(C(N)=O)nn1C |
| InChI | InChI=1S/C6H8BrN3O/c1-3-4(7)5(6(8)11)9-10(3)2/h1-2H3,(H2,8,11) |
| InChIKey | LDQNGCAUQYCYMC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1,5-dimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,5-dimethylpyrazole-3-carboxamide?
The IUPAC name of 4-bromo-1,5-dimethylpyrazole-3-carboxamide (CID 843437) is 4-bromo-1,5-dimethylpyrazole-3-carboxamide.
What is the SMILES notation for 4-bromo-1,5-dimethylpyrazole-3-carboxamide?
The canonical SMILES for 4-bromo-1,5-dimethylpyrazole-3-carboxamide is Cc1c(Br)c(C(N)=O)nn1C.
What is the InChIKey of 4-bromo-1,5-dimethylpyrazole-3-carboxamide?
The InChIKey is LDQNGCAUQYCYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3O/c1-3-4(7)5(6(8)11)9-10(3)2/h1-2H3,(H2,8,11).
What are the key properties of 4-bromo-1,5-dimethylpyrazole-3-carboxamide?
4-bromo-1,5-dimethylpyrazole-3-carboxamide has a molecular weight of 218.05 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,5-dimethylpyrazole-3-carboxamide is sourced from PubChem (CID 843437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).