About 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione
4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 843614) has the molecular formula C16H18N4S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione |
| PubChem CID | 843614 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1cc(-c2n[nH]c(=S)n2CC)c2ccccc2n1 |
| InChI | InChI=1S/C16H18N4S/c1-3-7-11-10-13(12-8-5-6-9-14(12)17-11)15-18-19-16(21)20(15)4-2/h5-6,8-10H,3-4,7H2,1-2H3,(H,19,21) |
| InChIKey | NPCZHRKMVUPFNJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione?
The IUPAC name of 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione (CID 843614) is 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione is CCCc1cc(-c2n[nH]c(=S)n2CC)c2ccccc2n1.
What is the InChIKey of 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione?
The InChIKey is NPCZHRKMVUPFNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4S/c1-3-7-11-10-13(12-8-5-6-9-14(12)17-11)15-18-19-16(21)20(15)4-2/h5-6,8-10H,3-4,7H2,1-2H3,(H,19,21).
What are the key properties of 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione?
4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione has a molecular weight of 298.41 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-(2-propylquinolin-4-yl)-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 843614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).