C12H19N7OS — CID 843743
(2R)-2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide (PubChem CID 843743) has the molecular formula C12H19N7OS and a molecular weight of 309.40 g/mol. Its IUPAC name is (2R)-2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide.
| Compound Name | (2R)-2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 843743 |
| Molecular Formula | C12H19N7OS |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2R)-2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide |
| SMILES | CSc1nc(N(C)C)nc(N(C#N)[C@H](C)C(=O)N(C)C)n1 |
| InChI | InChI=1S/C12H19N7OS/c1-8(9(20)17(2)3)19(7-13)11-14-10(18(4)5)15-12(16-11)21-6/h8H,1-6H3/t8-/m1/s1 |
| InChIKey | FUOWUJACNMYASX-MRVPVSSYSA-N |
| XLogP | 0.42 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|