About methyl N-(3,3-diphenylpropyl)carbamate
methyl N-(3,3-diphenylpropyl)carbamate (PubChem CID 844094) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl N-(3,3-diphenylpropyl)carbamate.
Molecular Properties
| Compound Name | methyl N-(3,3-diphenylpropyl)carbamate |
| PubChem CID | 844094 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl N-(3,3-diphenylpropyl)carbamate |
| SMILES | COC(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-20-17(19)18-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3,(H,18,19) |
| InChIKey | XYUDYANMAIPTEC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl N-(3,3-diphenylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(3,3-diphenylpropyl)carbamate?
The IUPAC name of methyl N-(3,3-diphenylpropyl)carbamate (CID 844094) is methyl N-(3,3-diphenylpropyl)carbamate.
What is the SMILES notation for methyl N-(3,3-diphenylpropyl)carbamate?
The canonical SMILES for methyl N-(3,3-diphenylpropyl)carbamate is COC(=O)NCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl N-(3,3-diphenylpropyl)carbamate?
The InChIKey is XYUDYANMAIPTEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-20-17(19)18-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3,(H,18,19).
What are the key properties of methyl N-(3,3-diphenylpropyl)carbamate?
methyl N-(3,3-diphenylpropyl)carbamate has a molecular weight of 269.34 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,3-diphenylpropyl)carbamate is sourced from PubChem (CID 844094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).