About N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide
N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide (PubChem CID 844580) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide |
| PubChem CID | 844580 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc3c(c2)CCC3)cn1 |
| InChI | InChI=1S/C14H15N3O/c1-17-9-12(8-15-17)14(18)16-13-6-5-10-3-2-4-11(10)7-13/h5-9H,2-4H2,1H3,(H,16,18) |
| InChIKey | YNDAWRFPSROKBH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide?
The IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide (CID 844580) is N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide?
The canonical SMILES for N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide is Cn1cc(C(=O)Nc2ccc3c(c2)CCC3)cn1.
What is the InChIKey of N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide?
The InChIKey is YNDAWRFPSROKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-17-9-12(8-15-17)14(18)16-13-6-5-10-3-2-4-11(10)7-13/h5-9H,2-4H2,1H3,(H,16,18).
What are the key properties of N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide?
N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide has a molecular weight of 241.29 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 844580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).