C6H12N3O4P — CID 845
[2-amino-3-(1H-imidazol-5-yl)propyl] dihydrogen phosphate (PubChem CID 845) has the molecular formula C6H12N3O4P and a molecular weight of 221.15 g/mol. Its IUPAC name is [2-amino-3-(1H-imidazol-5-yl)propyl] dihydrogen phosphate.
| Compound Name | [2-amino-3-(1H-imidazol-5-yl)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 845 |
| Molecular Formula | C6H12N3O4P |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | [2-amino-3-(1H-imidazol-5-yl)propyl] dihydrogen phosphate |
| SMILES | NC(COP(=O)(O)O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C6H12N3O4P/c7-5(3-13-14(10,11)12)1-6-2-8-4-9-6/h2,4-5H,1,3,7H2,(H,8,9)(H2,10,11,12) |
| InChIKey | CWNDERHTHMWBSI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|