About 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide
3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 84507992) has the molecular formula C19H15N3OS
and a molecular weight of 333.42 g/mol. Its IUPAC name is 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide.
Molecular Properties
| Compound Name | 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide |
| PubChem CID | 84507992 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCCc2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H15N3OS/c20-12-14-5-4-8-16(11-14)18(23)21-10-9-17-13-24-19(22-17)15-6-2-1-3-7-15/h1-8,11,13H,9-10H2,(H,21,23) |
| InChIKey | YYDVPSZJVKQPNH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide?
The IUPAC name of 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide (CID 84507992) is 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide.
What is the SMILES notation for 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide?
The canonical SMILES for 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide is N#Cc1cccc(C(=O)NCCc2csc(-c3ccccc3)n2)c1.
What is the InChIKey of 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide?
The InChIKey is YYDVPSZJVKQPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3OS/c20-12-14-5-4-8-16(11-14)18(23)21-10-9-17-13-24-19(22-17)15-6-2-1-3-7-15/h1-8,11,13H,9-10H2,(H,21,23).
What are the key properties of 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide?
3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide has a molecular weight of 333.42 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide is sourced from PubChem (CID 84507992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).