About benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate
benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate (PubChem CID 84513144) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate |
| PubChem CID | 84513144 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate |
| SMILES | Cc1noc(C)c1-c1ccc(NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2O3/c1-13-18(14(2)24-21-13)16-8-10-17(11-9-16)20-19(22)23-12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,20,22) |
| InChIKey | YKMGNOQIDOYFCL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate?
The IUPAC name of benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate (CID 84513144) is benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate.
What is the SMILES notation for benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate?
The canonical SMILES for benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate is Cc1noc(C)c1-c1ccc(NC(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate?
The InChIKey is YKMGNOQIDOYFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-13-18(14(2)24-21-13)16-8-10-17(11-9-16)20-19(22)23-12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,20,22).
What are the key properties of benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate?
benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate has a molecular weight of 322.36 g/mol, XLogP of 4.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]carbamate is sourced from PubChem (CID 84513144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).