About [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea
[[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea (PubChem CID 845178) has the molecular formula C8H13N3O3S
and a molecular weight of 231.28 g/mol. Its IUPAC name is [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea.
Molecular Properties
| Compound Name | [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea |
| PubChem CID | 845178 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea |
| SMILES | C[C@H]1C[C@@H](CC(=O)NNC(N)=S)C(=O)O1 |
| InChI | InChI=1S/C8H13N3O3S/c1-4-2-5(7(13)14-4)3-6(12)10-11-8(9)15/h4-5H,2-3H2,1H3,(H,10,12)(H3,9,11,15)/t4-,5-/m0/s1 |
| InChIKey | MRRZEWODDZDCMY-WHFBIAKZSA-N |
| XLogP | -0.81 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea?
The IUPAC name of [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea (CID 845178) is [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea.
What is the SMILES notation for [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea?
The canonical SMILES for [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea is C[C@H]1C[C@@H](CC(=O)NNC(N)=S)C(=O)O1.
What is the InChIKey of [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea?
The InChIKey is MRRZEWODDZDCMY-WHFBIAKZSA-N. The full InChI is InChI=1S/C8H13N3O3S/c1-4-2-5(7(13)14-4)3-6(12)10-11-8(9)15/h4-5H,2-3H2,1H3,(H,10,12)(H3,9,11,15)/t4-,5-/m0/s1.
What are the key properties of [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea?
[[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea has a molecular weight of 231.28 g/mol, XLogP of -0.81, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]acetyl]amino]thiourea is sourced from PubChem (CID 845178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).