C11H7Cl3N2O2S — CID 845363
2,3,5-trichloro-6-[2-(dimethylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 845363) has the molecular formula C11H7Cl3N2O2S and a molecular weight of 337.62 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[2-(dimethylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trichloro-6-[2-(dimethylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 845363 |
| Molecular Formula | C11H7Cl3N2O2S |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | 2,3,5-trichloro-6-[2-(dimethylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CN(C)c1ncc(C2=C(Cl)C(=O)C(Cl)=C(Cl)C2=O)s1 |
| InChI | InChI=1S/C11H7Cl3N2O2S/c1-16(2)11-15-3-4(19-11)5-6(12)10(18)8(14)7(13)9(5)17/h3H,1-2H3 |
| InChIKey | AFESZQGJDOMBDZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|