C13H13N3O4 — CID 84550021
N-(4-hydroxyphenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 84550021) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 84550021 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(4-hydroxyphenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(O)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H13N3O4/c1-15-7-10(12(19)16(2)13(15)20)11(18)14-8-3-5-9(17)6-4-8/h3-7,17H,1-2H3,(H,14,18) |
| InChIKey | SQYVEHPGFACKME-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|