C15H21N3O2 — CID 84550235
1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 84550235) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 84550235 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-5-14(19)17-8-4-9-18(11-10-17)15(20)13-6-3-7-16-12-13/h3,6-7,12H,2,4-5,8-11H2,1H3 |
| InChIKey | UWXQJADEHMMWRC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |