C22H27NO2 — CID 84552099
(E)-N-(2-butan-2-ylphenyl)-3-(4-methoxy-2,6-dimethylphenyl)prop-2-enamide (PubChem CID 84552099) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (E)-N-(2-butan-2-ylphenyl)-3-(4-methoxy-2,6-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-butan-2-ylphenyl)-3-(4-methoxy-2,6-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 84552099 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (E)-N-(2-butan-2-ylphenyl)-3-(4-methoxy-2,6-dimethylphenyl)prop-2-enamide |
| SMILES | CCC(C)c1ccccc1NC(=O)/C=C/c1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C22H27NO2/c1-6-15(2)20-9-7-8-10-21(20)23-22(24)12-11-19-16(3)13-18(25-5)14-17(19)4/h7-15H,6H2,1-5H3,(H,23,24)/b12-11+ |
| InChIKey | JFFZMXOSFQOAMW-VAWYXSNFSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|