C17H16N2O5S — CID 84552104
(E)-N-[4-(acetylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 84552104) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (E)-N-[4-(acetylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(acetylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 84552104 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (E)-N-[4-(acetylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)/C=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-12(20)19-25(23,24)16-9-5-14(6-10-16)18-17(22)11-4-13-2-7-15(21)8-3-13/h2-11,21H,1H3,(H,18,22)(H,19,20)/b11-4+ |
| InChIKey | OTPFCAZTZRLYJX-NYYWCZLTSA-N |
| XLogP | 1.87 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|