C14H13F3N2O2S — CID 84554452
N-(2-propoxyphenyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 84554452) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is N-(2-propoxyphenyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-propoxyphenyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 84554452 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(2-propoxyphenyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCOc1ccccc1NC(=O)c1scnc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O2S/c1-2-7-21-10-6-4-3-5-9(10)19-13(20)11-12(14(15,16)17)18-8-22-11/h3-6,8H,2,7H2,1H3,(H,19,20) |
| InChIKey | LLZJZYWVYYOZMI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |