C11H15N3O4 — CID 84556889
1,3-dimethyl-5-(morpholine-4-carbonyl)pyrimidine-2,4-dione (PubChem CID 84556889) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-(morpholine-4-carbonyl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(morpholine-4-carbonyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 84556889 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1,3-dimethyl-5-(morpholine-4-carbonyl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(C(=O)N2CCOCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H15N3O4/c1-12-7-8(9(15)13(2)11(12)17)10(16)14-3-5-18-6-4-14/h7H,3-6H2,1-2H3 |
| InChIKey | TWGOBMYGZPDLSV-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |