C18H17N3O4 — CID 84561430
2-hydroxy-5-[3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanoylamino]benzoic acid (PubChem CID 84561430) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-hydroxy-5-[3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanoylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 84561430 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-hydroxy-5-[3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanoylamino]benzoic acid |
| SMILES | Cc1nc2ccccn2c1CCC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-11-14(21-9-3-2-4-16(21)19-11)6-8-17(23)20-12-5-7-15(22)13(10-12)18(24)25/h2-5,7,9-10,22H,6,8H2,1H3,(H,20,23)(H,24,25) |
| InChIKey | NJDCQSUYOUXUIA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|