About 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate
3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate (PubChem CID 84562559) has the molecular formula C16H14N2O3S
and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate.
Molecular Properties
| Compound Name | 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate |
| PubChem CID | 84562559 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate |
| SMILES | N#Cc1cccc(C(=O)OCCCNC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H14N2O3S/c17-11-12-4-1-5-13(10-12)16(20)21-8-3-7-18-15(19)14-6-2-9-22-14/h1-2,4-6,9-10H,3,7-8H2,(H,18,19) |
| InChIKey | XXHQKCGNRZYJSY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate?
The IUPAC name of 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate (CID 84562559) is 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate.
What is the SMILES notation for 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate?
The canonical SMILES for 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate is N#Cc1cccc(C(=O)OCCCNC(=O)c2cccs2)c1.
What is the InChIKey of 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate?
The InChIKey is XXHQKCGNRZYJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3S/c17-11-12-4-1-5-13(10-12)16(20)21-8-3-7-18-15(19)14-6-2-9-22-14/h1-2,4-6,9-10H,3,7-8H2,(H,18,19).
What are the key properties of 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate?
3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate has a molecular weight of 314.37 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thiophene-2-carbonylamino)propyl 3-cyanobenzoate is sourced from PubChem (CID 84562559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).