C21H19F3N2O4 — CID 84563120
2-(6-butanoyl-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 84563120) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is 2-(6-butanoyl-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(6-butanoyl-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 84563120 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(6-butanoyl-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCC(=O)c1ccc2c(c1)N(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C(C)O2 |
| InChI | InChI=1S/C21H19F3N2O4/c1-3-4-16(27)12-5-8-17-15(9-12)26(21(29)11(2)30-17)10-18(28)25-14-7-6-13(22)19(23)20(14)24/h5-9,11H,3-4,10H2,1-2H3,(H,25,28) |
| InChIKey | MLMKCJXQXPUCMI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|