C23H24N4OS — CID 84565103
N-(3-imidazol-1-ylpropyl)-2-[4-methyl-2-(naphthalen-1-ylmethyl)-1,3-thiazol-5-yl]acetamide (PubChem CID 84565103) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[4-methyl-2-(naphthalen-1-ylmethyl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[4-methyl-2-(naphthalen-1-ylmethyl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 84565103 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[4-methyl-2-(naphthalen-1-ylmethyl)-1,3-thiazol-5-yl]acetamide |
| SMILES | Cc1nc(Cc2cccc3ccccc23)sc1CC(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C23H24N4OS/c1-17-21(15-22(28)25-10-5-12-27-13-11-24-16-27)29-23(26-17)14-19-8-4-7-18-6-2-3-9-20(18)19/h2-4,6-9,11,13,16H,5,10,12,14-15H2,1H3,(H,25,28) |
| InChIKey | KUHYMYMUEYDJFR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|