C21H29N3O5 — CID 84565797
1-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoyl]piperidine-4-carboxamide (PubChem CID 84565797) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 84565797 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoyl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1OCC(=O)N(CCC(=O)N1CCC(C(N)=O)CC1)C1CC1 |
| InChI | InChI=1S/C21H29N3O5/c1-28-17-4-2-3-5-18(17)29-14-20(26)24(16-6-7-16)13-10-19(25)23-11-8-15(9-12-23)21(22)27/h2-5,15-16H,6-14H2,1H3,(H2,22,27) |
| InChIKey | RHLWBGYAVVGMMX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |