C23H36N4O3 — CID 84566540
3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 84566540) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | 3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 84566540 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN(CCC(=O)NCCCN2CCOCC2)C2CC2)c1 |
| InChI | InChI=1S/C23H36N4O3/c1-18-4-5-19(2)21(16-18)25-23(29)17-27(20-6-7-20)11-8-22(28)24-9-3-10-26-12-14-30-15-13-26/h4-5,16,20H,3,6-15,17H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | CJJWGCWOLKEENF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|