C19H20N2S — CID 84566788
4-naphthalen-2-yl-2-(piperidin-1-ylmethyl)-1,3-thiazole (PubChem CID 84566788) has the molecular formula C19H20N2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 4-naphthalen-2-yl-2-(piperidin-1-ylmethyl)-1,3-thiazole.
| Compound Name | 4-naphthalen-2-yl-2-(piperidin-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 84566788 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-naphthalen-2-yl-2-(piperidin-1-ylmethyl)-1,3-thiazole |
| SMILES | c1ccc2cc(-c3csc(CN4CCCCC4)n3)ccc2c1 |
| InChI | InChI=1S/C19H20N2S/c1-4-10-21(11-5-1)13-19-20-18(14-22-19)17-9-8-15-6-2-3-7-16(15)12-17/h2-3,6-9,12,14H,1,4-5,10-11,13H2 |
| InChIKey | ITDTVXFVUICTAN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |