C19H28N6O2S — CID 84567123
1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-imidazol-1-ylpropyl)piperidine-3-carboxamide (PubChem CID 84567123) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-imidazol-1-ylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-imidazol-1-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 84567123 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-imidazol-1-ylpropyl)piperidine-3-carboxamide |
| SMILES | Cc1nc(NC(=O)CN2CCCC(C(=O)NCCCn3ccnc3)C2)sc1C |
| InChI | InChI=1S/C19H28N6O2S/c1-14-15(2)28-19(22-14)23-17(26)12-25-8-3-5-16(11-25)18(27)21-6-4-9-24-10-7-20-13-24/h7,10,13,16H,3-6,8-9,11-12H2,1-2H3,(H,21,27)(H,22,23,26) |
| InChIKey | PYVATNSMWAJFDF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|