C22H25N3O3S — CID 84567683
3-[cyclopropyl(naphthalen-1-ylmethyl)amino]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide (PubChem CID 84567683) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-[cyclopropyl(naphthalen-1-ylmethyl)amino]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide.
| Compound Name | 3-[cyclopropyl(naphthalen-1-ylmethyl)amino]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 84567683 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[cyclopropyl(naphthalen-1-ylmethyl)amino]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide |
| SMILES | O=C(CCN(Cc1cccc2ccccc12)C1CC1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C22H25N3O3S/c26-20(23-11-13-25-21(27)15-29-22(25)28)10-12-24(18-8-9-18)14-17-6-3-5-16-4-1-2-7-19(16)17/h1-7,18H,8-15H2,(H,23,26) |
| InChIKey | QHXZNDJIQIKIHD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|