C23H26N4O2S — CID 84568133
[4-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]phenyl] thiocyanate (PubChem CID 84568133) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is [4-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]phenyl] thiocyanate.
| Compound Name | [4-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 84568133 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [4-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]phenyl] thiocyanate |
| SMILES | Cc1ccc(C)c(NC(=O)CN(CCC(=O)Nc2ccc(SC#N)cc2)C2CC2)c1 |
| InChI | InChI=1S/C23H26N4O2S/c1-16-3-4-17(2)21(13-16)26-23(29)14-27(19-7-8-19)12-11-22(28)25-18-5-9-20(10-6-18)30-15-24/h3-6,9-10,13,19H,7-8,11-12,14H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | LODDRBIHNWFITR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|