C24H24N2O4 — CID 84568655
5-[3-[cyclopropyl(naphthalen-1-ylmethyl)amino]propanoylamino]-2-hydroxybenzoic acid (PubChem CID 84568655) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 5-[3-[cyclopropyl(naphthalen-1-ylmethyl)amino]propanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[3-[cyclopropyl(naphthalen-1-ylmethyl)amino]propanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 84568655 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 5-[3-[cyclopropyl(naphthalen-1-ylmethyl)amino]propanoylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(CCN(Cc1cccc2ccccc12)C1CC1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H24N2O4/c27-22-11-8-18(14-21(22)24(29)30)25-23(28)12-13-26(19-9-10-19)15-17-6-3-5-16-4-1-2-7-20(16)17/h1-8,11,14,19,27H,9-10,12-13,15H2,(H,25,28)(H,29,30) |
| InChIKey | BZZRQERJRHKSRQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|