C19H23N3O3 — CID 84570649
6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,2-dimethoxyethyl)pyridine-3-carboxamide (PubChem CID 84570649) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,2-dimethoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,2-dimethoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84570649 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,2-dimethoxyethyl)pyridine-3-carboxamide |
| SMILES | COC(CNC(=O)c1ccc(N2CCc3ccccc3C2)nc1)OC |
| InChI | InChI=1S/C19H23N3O3/c1-24-18(25-2)12-21-19(23)15-7-8-17(20-11-15)22-10-9-14-5-3-4-6-16(14)13-22/h3-8,11,18H,9-10,12-13H2,1-2H3,(H,21,23) |
| InChIKey | CVAWPROAKHTZHK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|