C27H25N3O — CID 84571615
2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-1-(1H-indol-3-yl)ethanone (PubChem CID 84571615) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 84571615 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-1-(1H-indol-3-yl)ethanone |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccccc3n2CC(=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H25N3O/c1-27(2,3)19-14-12-18(13-15-19)26-29-23-10-6-7-11-24(23)30(26)17-25(31)21-16-28-22-9-5-4-8-20(21)22/h4-16,28H,17H2,1-3H3 |
| InChIKey | UCOHPUQMRUPPPJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |