C21H24N2 — CID 84571658
1-but-3-enyl-2-(4-tert-butylphenyl)benzimidazole (PubChem CID 84571658) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-but-3-enyl-2-(4-tert-butylphenyl)benzimidazole.
| Compound Name | 1-but-3-enyl-2-(4-tert-butylphenyl)benzimidazole |
|---|---|
| PubChem CID | 84571658 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-but-3-enyl-2-(4-tert-butylphenyl)benzimidazole |
| SMILES | C=CCCn1c(-c2ccc(C(C)(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H24N2/c1-5-6-15-23-19-10-8-7-9-18(19)22-20(23)16-11-13-17(14-12-16)21(2,3)4/h5,7-14H,1,6,15H2,2-4H3 |
| InChIKey | ONRDOLOZTCACCH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|