C24H27NO5 — CID 84572393
1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-(3-phenoxypropoxy)pyridin-4-one (PubChem CID 84572393) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-(3-phenoxypropoxy)pyridin-4-one.
| Compound Name | 1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-(3-phenoxypropoxy)pyridin-4-one |
|---|---|
| PubChem CID | 84572393 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-(3-phenoxypropoxy)pyridin-4-one |
| SMILES | COc1ccc(OCCn2ccc(=O)c(OCCCOc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-19-24(30-17-6-16-28-21-7-4-3-5-8-21)23(26)13-14-25(19)15-18-29-22-11-9-20(27-2)10-12-22/h3-5,7-14H,6,15-18H2,1-2H3 |
| InChIKey | QBDKLCYGQGJYSR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|