C18H19NO4 — CID 84572566
1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-prop-2-ynoxypyridin-4-one (PubChem CID 84572566) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-prop-2-ynoxypyridin-4-one.
| Compound Name | 1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-prop-2-ynoxypyridin-4-one |
|---|---|
| PubChem CID | 84572566 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-3-prop-2-ynoxypyridin-4-one |
| SMILES | C#CCOc1c(C)n(CCOc2ccc(OC)cc2)ccc1=O |
| InChI | InChI=1S/C18H19NO4/c1-4-12-23-18-14(2)19(10-9-17(18)20)11-13-22-16-7-5-15(21-3)6-8-16/h1,5-10H,11-13H2,2-3H3 |
| InChIKey | YLXWVFZMLJQDIN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|