C26H24F3N3O — CID 84572802
2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 84572802) has the molecular formula C26H24F3N3O and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 84572802 |
| Molecular Formula | C26H24F3N3O |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)benzimidazol-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccccc3n2CC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H24F3N3O/c1-25(2,3)18-13-11-17(12-14-18)24-31-21-9-4-5-10-22(21)32(24)16-23(33)30-20-8-6-7-19(15-20)26(27,28)29/h4-15H,16H2,1-3H3,(H,30,33) |
| InChIKey | NZPRPDFUQDUVQQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |