C17H25N3O3 — CID 84574009
[2-(2-hydroxyethyl)piperidin-1-yl]-(6-morpholin-4-yl-2-pyridinyl)methanone (PubChem CID 84574009) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)piperidin-1-yl]-(6-morpholin-4-yl-2-pyridinyl)methanone.
| Compound Name | [2-(2-hydroxyethyl)piperidin-1-yl]-(6-morpholin-4-yl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 84574009 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [2-(2-hydroxyethyl)piperidin-1-yl]-(6-morpholin-4-yl-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(N2CCOCC2)n1)N1CCCCC1CCO |
| InChI | InChI=1S/C17H25N3O3/c21-11-7-14-4-1-2-8-20(14)17(22)15-5-3-6-16(18-15)19-9-12-23-13-10-19/h3,5-6,14,21H,1-2,4,7-13H2 |
| InChIKey | XBQZIZMLWONSSR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |