C18H19N3O — CID 84574378
6-(3,4-dihydro-2H-quinolin-1-yl)-N-prop-2-enylpyridine-2-carboxamide (PubChem CID 84574378) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-quinolin-1-yl)-N-prop-2-enylpyridine-2-carboxamide.
| Compound Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N-prop-2-enylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 84574378 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N-prop-2-enylpyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1cccc(N2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C18H19N3O/c1-2-12-19-18(22)15-9-5-11-17(20-15)21-13-6-8-14-7-3-4-10-16(14)21/h2-5,7,9-11H,1,6,8,12-13H2,(H,19,22) |
| InChIKey | BOQSDEIZHCZWGK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|