C15H23N3O2 — CID 84574689
2-(azepan-1-yl)-N-(2-hydroxyethyl)-N-methylpyridine-4-carboxamide (PubChem CID 84574689) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-(2-hydroxyethyl)-N-methylpyridine-4-carboxamide.
| Compound Name | 2-(azepan-1-yl)-N-(2-hydroxyethyl)-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 84574689 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-(azepan-1-yl)-N-(2-hydroxyethyl)-N-methylpyridine-4-carboxamide |
| SMILES | CN(CCO)C(=O)c1ccnc(N2CCCCCC2)c1 |
| InChI | InChI=1S/C15H23N3O2/c1-17(10-11-19)15(20)13-6-7-16-14(12-13)18-8-4-2-3-5-9-18/h6-7,12,19H,2-5,8-11H2,1H3 |
| InChIKey | IMNOPGHJWZDVFV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |