C20H25N3O — CID 84575233
2-piperidin-1-yl-N-(2,4,6-trimethylphenyl)pyridine-3-carboxamide (PubChem CID 84575233) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-(2,4,6-trimethylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-piperidin-1-yl-N-(2,4,6-trimethylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84575233 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-piperidin-1-yl-N-(2,4,6-trimethylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cccnc2N2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O/c1-14-12-15(2)18(16(3)13-14)22-20(24)17-8-7-9-21-19(17)23-10-5-4-6-11-23/h7-9,12-13H,4-6,10-11H2,1-3H3,(H,22,24) |
| InChIKey | FFBNZYHFTLGJAV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |