C13H14N2OS — CID 84576927
N-(2,6-dimethylphenyl)-5-methyl-1,2-thiazole-3-carboxamide (PubChem CID 84576927) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-5-methyl-1,2-thiazole-3-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-5-methyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 84576927 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-(2,6-dimethylphenyl)-5-methyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2c(C)cccc2C)ns1 |
| InChI | InChI=1S/C13H14N2OS/c1-8-5-4-6-9(2)12(8)14-13(16)11-7-10(3)17-15-11/h4-7H,1-3H3,(H,14,16) |
| InChIKey | QHOIZNNDZPALNR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |