About 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide
5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide (PubChem CID 84578114) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide |
| PubChem CID | 84578114 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1ncc(C)o1 |
| InChI | InChI=1S/C11H14N2O2/c1-4-6-13(7-5-2)11(14)10-12-8-9(3)15-10/h4-5,8H,1-2,6-7H2,3H3 |
| InChIKey | KRZUVSSUNLRAGD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide?
The IUPAC name of 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide (CID 84578114) is 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide.
What is the SMILES notation for 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide?
The canonical SMILES for 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide is C=CCN(CC=C)C(=O)c1ncc(C)o1.
What is the InChIKey of 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide?
The InChIKey is KRZUVSSUNLRAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-4-6-13(7-5-2)11(14)10-12-8-9(3)15-10/h4-5,8H,1-2,6-7H2,3H3.
What are the key properties of 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide?
5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide has a molecular weight of 206.24 g/mol, XLogP of 1.80, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,N-bis(prop-2-enyl)-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 84578114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).