C21H21N3O — CID 84578480
N-[2-(1H-indol-3-yl)ethyl]-3,5-dimethyl-1H-indole-2-carboxamide (PubChem CID 84578480) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-3,5-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-3,5-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 84578480 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-3,5-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)NCCc3c[nH]c4ccccc34)c(C)c2c1 |
| InChI | InChI=1S/C21H21N3O/c1-13-7-8-19-17(11-13)14(2)20(24-19)21(25)22-10-9-15-12-23-18-6-4-3-5-16(15)18/h3-8,11-12,23-24H,9-10H2,1-2H3,(H,22,25) |
| InChIKey | IQKIDNHPFHBMFT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|