C14H11F3N2O2 — CID 84580545
6-methoxy-N-[2-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 84580545) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is 6-methoxy-N-[2-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-[2-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84580545 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6-methoxy-N-[2-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H11F3N2O2/c1-21-12-7-6-9(8-18-12)13(20)19-11-5-3-2-4-10(11)14(15,16)17/h2-8H,1H3,(H,19,20) |
| InChIKey | AJLROTDYIBDLJA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |