C12H16N2O3 — CID 84580776
4-(2,4-dimethylfuran-3-carbonyl)piperazine-1-carbaldehyde (PubChem CID 84580776) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(2,4-dimethylfuran-3-carbonyl)piperazine-1-carbaldehyde.
| Compound Name | 4-(2,4-dimethylfuran-3-carbonyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 84580776 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-(2,4-dimethylfuran-3-carbonyl)piperazine-1-carbaldehyde |
| SMILES | Cc1coc(C)c1C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C12H16N2O3/c1-9-7-17-10(2)11(9)12(16)14-5-3-13(8-15)4-6-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | NCEPBEUKCICYSX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|