About ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate
ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate (PubChem CID 84581564) has the molecular formula C15H19F2NO2
and a molecular weight of 283.32 g/mol. Its IUPAC name is ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate |
| PubChem CID | 84581564 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate |
| SMILES | CCOC(=O)NCC1(c2ccc(F)cc2F)CC1(C)C |
| InChI | InChI=1S/C15H19F2NO2/c1-4-20-13(19)18-9-15(8-14(15,2)3)11-6-5-10(16)7-12(11)17/h5-7H,4,8-9H2,1-3H3,(H,18,19) |
| InChIKey | CAYSVWZEXVRDGZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate?
The IUPAC name of ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate (CID 84581564) is ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate.
What is the SMILES notation for ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate?
The canonical SMILES for ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate is CCOC(=O)NCC1(c2ccc(F)cc2F)CC1(C)C.
What is the InChIKey of ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate?
The InChIKey is CAYSVWZEXVRDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO2/c1-4-20-13(19)18-9-15(8-14(15,2)3)11-6-5-10(16)7-12(11)17/h5-7H,4,8-9H2,1-3H3,(H,18,19).
What are the key properties of ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate?
ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate has a molecular weight of 283.32 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[1-(2,4-difluorophenyl)-2,2-dimethylcyclopropyl]methyl]carbamate is sourced from PubChem (CID 84581564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).