C22H25N3O — CID 84582311
4-(dimethylamino)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide (PubChem CID 84582311) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide.
| Compound Name | 4-(dimethylamino)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide |
|---|---|
| PubChem CID | 84582311 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 4-(dimethylamino)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC(NC(=O)c1ccc(N(C)C)cc1)C3 |
| InChI | InChI=1S/C22H25N3O/c1-14-4-11-20-19(12-14)18-10-7-16(13-21(18)24-20)23-22(26)15-5-8-17(9-6-15)25(2)3/h4-6,8-9,11-12,16,24H,7,10,13H2,1-3H3,(H,23,26) |
| InChIKey | AQVHFZRYJNQMSG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|