C27H28N4O5S — CID 84582855
N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-[(2E)-2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]benzamide;sulfuric acid (PubChem CID 84582855) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-[(2E)-2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]benzamide;sulfuric acid.
| Compound Name | N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-[(2E)-2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]benzamide;sulfuric acid |
|---|---|
| PubChem CID | 84582855 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-[(2E)-2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]benzamide;sulfuric acid |
| SMILES | CC(=Cc1ccccc1)/C=N/Nc1ccc(C(=O)NN=C/C(C)=C\c2ccccc2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C27H26N4O.H2O4S/c1-21(17-23-9-5-3-6-10-23)19-28-30-26-15-13-25(14-16-26)27(32)31-29-20-22(2)18-24-11-7-4-8-12-24;1-5(2,3)4/h3-20,30H,1-2H3,(H,31,32);(H2,1,2,3,4)/b21-17?,22-18-,28-19+,29-20?; |
| InChIKey | TTXBIEUDOPCNQU-FHBMMOLTSA-N |
| XLogP | 5.35 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|