About 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide
2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 84583503) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 84583503 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-10(2,3)9-11-7(6-14-9)8(13)12(4)5/h6H,1-5H3 |
| InChIKey | LVYHTCLZVYUDMU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide (CID 84583503) is 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide is CN(C)C(=O)c1csc(C(C)(C)C)n1.
What is the InChIKey of 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The InChIKey is LVYHTCLZVYUDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-10(2,3)9-11-7(6-14-9)8(13)12(4)5/h6H,1-5H3.
What are the key properties of 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide?
2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide has a molecular weight of 212.32 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N,N-dimethyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 84583503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).