About 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone (PubChem CID 84583797) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone |
| PubChem CID | 84583797 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone |
| SMILES | CC(C)c1ocnc1C(=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H20N2O4/c1-10(2)12-11(15-9-18-12)13(17)16-5-3-14(4-6-16)19-7-8-20-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | KEXVIHKQHRJASW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
The IUPAC name of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone (CID 84583797) is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone.
What is the SMILES notation for 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
The canonical SMILES for 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone is CC(C)c1ocnc1C(=O)N1CCC2(CC1)OCCO2.
What is the InChIKey of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
The InChIKey is KEXVIHKQHRJASW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-10(2)12-11(15-9-18-12)13(17)16-5-3-14(4-6-16)19-7-8-20-14/h9-10H,3-8H2,1-2H3.
What are the key properties of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone has a molecular weight of 280.32 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone is sourced from PubChem (CID 84583797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).