About N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide
N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide (PubChem CID 84584476) has the molecular formula C12H10Cl2N2O4S
and a molecular weight of 349.20 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 84584476 |
| Molecular Formula | C12H10Cl2N2O4S |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide |
| SMILES | CCc1ocnc1C(=O)NS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O4S/c1-2-9-10(15-6-20-9)12(17)16-21(18,19)11-7(13)4-3-5-8(11)14/h3-6H,2H2,1H3,(H,16,17) |
| InChIKey | JVLCTUFCFHDHHZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide (CID 84584476) is N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide is CCc1ocnc1C(=O)NS(=O)(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide?
The InChIKey is JVLCTUFCFHDHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2O4S/c1-2-9-10(15-6-20-9)12(17)16-21(18,19)11-7(13)4-3-5-8(11)14/h3-6H,2H2,1H3,(H,16,17).
What are the key properties of N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide?
N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide has a molecular weight of 349.20 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)sulfonyl-5-ethyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 84584476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).